C17H20ClFN2O2 — CID 119601230
N-[2-(aminomethyl)cyclopentyl]-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride (PubChem CID 119601230) has the molecular formula C17H20ClFN2O2 and a molecular weight of 338.81 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119601230 |
| Molecular Formula | C17H20ClFN2O2 |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C17H19FN2O2.ClH/c18-13-6-2-1-5-12(13)15-8-9-16(22-15)17(21)20-14-7-3-4-11(14)10-19;/h1-2,5-6,8-9,11,14H,3-4,7,10,19H2,(H,20,21);1H |
| InChIKey | ONWHMYJURONZTG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |