C17H21FN2O2S — CID 119601294
N-[2-(aminomethyl)cyclopentyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 119601294) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 119601294 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)NC2CCCC2CN)sc2cccc(F)c12 |
| InChI | InChI=1S/C17H21FN2O2S/c1-22-9-11-15-12(18)5-3-7-14(15)23-16(11)17(21)20-13-6-2-4-10(13)8-19/h3,5,7,10,13H,2,4,6,8-9,19H2,1H3,(H,20,21) |
| InChIKey | CMZYTCAOIWIRHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |