C32H30N4O2S — CID 11960265
N-(2-aminophenyl)-6-[2-(benzylamino)-2-oxo-1-(2-phenylethylamino)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 11960265) has the molecular formula C32H30N4O2S and a molecular weight of 534.69 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[2-(benzylamino)-2-oxo-1-(2-phenylethylamino)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[2-(benzylamino)-2-oxo-1-(2-phenylethylamino)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11960265 |
| Molecular Formula | C32H30N4O2S |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-(2-aminophenyl)-6-[2-(benzylamino)-2-oxo-1-(2-phenylethylamino)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1cc2ccc(C(NCCc3ccccc3)C(=O)NCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C32H30N4O2S/c33-26-13-7-8-14-27(26)36-31(37)29-19-24-15-16-25(20-28(24)39-29)30(34-18-17-22-9-3-1-4-10-22)32(38)35-21-23-11-5-2-6-12-23/h1-16,19-20,30,34H,17-18,21,33H2,(H,35,38)(H,36,37) |
| InChIKey | VCMASJJHEZFVSU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|