C26H26N4O3S — CID 11960367
N-(2-aminophenyl)-6-[2-(benzylamino)-1-(2-hydroxyethylamino)-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 11960367) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[2-(benzylamino)-1-(2-hydroxyethylamino)-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[2-(benzylamino)-1-(2-hydroxyethylamino)-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11960367 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-(2-aminophenyl)-6-[2-(benzylamino)-1-(2-hydroxyethylamino)-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1cc2ccc(C(NCCO)C(=O)NCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C26H26N4O3S/c27-20-8-4-5-9-21(20)30-25(32)23-14-18-10-11-19(15-22(18)34-23)24(28-12-13-31)26(33)29-16-17-6-2-1-3-7-17/h1-11,14-15,24,28,31H,12-13,16,27H2,(H,29,33)(H,30,32) |
| InChIKey | DMXRAAPBIZGHSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|