C17H21ClN4O — CID 119602881
N-[2-(aminomethyl)cyclopentyl]-1-(4-chlorophenyl)-3-methylpyrazole-4-carboxamide (PubChem CID 119602881) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-1-(4-chlorophenyl)-3-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-1-(4-chlorophenyl)-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119602881 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-1-(4-chlorophenyl)-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)NC1CCCC1CN |
| InChI | InChI=1S/C17H21ClN4O/c1-11-15(17(23)20-16-4-2-3-12(16)9-19)10-22(21-11)14-7-5-13(18)6-8-14/h5-8,10,12,16H,2-4,9,19H2,1H3,(H,20,23) |
| InChIKey | ACQXWGIEIRPVFE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |