C18H25ClN2OS — CID 119604150
N-[2-(aminomethyl)cyclopentyl]-4-(1-benzothiophen-3-yl)butanamide;hydrochloride (PubChem CID 119604150) has the molecular formula C18H25ClN2OS and a molecular weight of 352.93 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-(1-benzothiophen-3-yl)butanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-(1-benzothiophen-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119604150 |
| Molecular Formula | C18H25ClN2OS |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-(1-benzothiophen-3-yl)butanamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)CCCc1csc2ccccc12 |
| InChI | InChI=1S/C18H24N2OS.ClH/c19-11-13-5-3-8-16(13)20-18(21)10-4-6-14-12-22-17-9-2-1-7-15(14)17;/h1-2,7,9,12-13,16H,3-6,8,10-11,19H2,(H,20,21);1H |
| InChIKey | ABCIHMJALHXHHI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |