C13H23ClN4O3 — CID 119610019
N-[2-(aminomethyl)cyclohexyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride (PubChem CID 119610019) has the molecular formula C13H23ClN4O3 and a molecular weight of 318.81 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119610019 |
| Molecular Formula | C13H23ClN4O3 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide;hydrochloride |
| SMILES | CN1CC(=O)N(CC(=O)NC2CCCCC2CN)C1=O.Cl |
| InChI | InChI=1S/C13H22N4O3.ClH/c1-16-8-12(19)17(13(16)20)7-11(18)15-10-5-3-2-4-9(10)6-14;/h9-10H,2-8,14H2,1H3,(H,15,18);1H |
| InChIKey | QPGUBYZHLPLQLN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|