C22H29ClN2O3 — CID 119612068
N-[2-(aminomethyl)cyclohexyl]-2-(2-phenylmethoxyphenoxy)acetamide;hydrochloride (PubChem CID 119612068) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(2-phenylmethoxyphenoxy)acetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(2-phenylmethoxyphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119612068 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(2-phenylmethoxyphenoxy)acetamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)COc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H28N2O3.ClH/c23-14-18-10-4-5-11-19(18)24-22(25)16-27-21-13-7-6-12-20(21)26-15-17-8-2-1-3-9-17;/h1-3,6-9,12-13,18-19H,4-5,10-11,14-16,23H2,(H,24,25);1H |
| InChIKey | UYHJVYMHFPWVOB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |