C15H18F2N2O2 — CID 119614643
N-(2-amino-1-cyclopropylethyl)-4-(3,4-difluorophenyl)-4-oxobutanamide (PubChem CID 119614643) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-(3,4-difluorophenyl)-4-oxobutanamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-(3,4-difluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 119614643 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-(3,4-difluorophenyl)-4-oxobutanamide |
| SMILES | NCC(NC(=O)CCC(=O)c1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C15H18F2N2O2/c16-11-4-3-10(7-12(11)17)14(20)5-6-15(21)19-13(8-18)9-1-2-9/h3-4,7,9,13H,1-2,5-6,8,18H2,(H,19,21) |
| InChIKey | RLJGYQQUTGZNGT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |