C19H22BrN3O — CID 119616555
N-(2-amino-1-cyclopropylethyl)-6-bromo-2-cyclopropyl-3-methylquinoline-4-carboxamide (PubChem CID 119616555) has the molecular formula C19H22BrN3O and a molecular weight of 388.31 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-6-bromo-2-cyclopropyl-3-methylquinoline-4-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-6-bromo-2-cyclopropyl-3-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 119616555 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-6-bromo-2-cyclopropyl-3-methylquinoline-4-carboxamide |
| SMILES | Cc1c(C2CC2)nc2ccc(Br)cc2c1C(=O)NC(CN)C1CC1 |
| InChI | InChI=1S/C19H22BrN3O/c1-10-17(19(24)23-16(9-21)11-2-3-11)14-8-13(20)6-7-15(14)22-18(10)12-4-5-12/h6-8,11-12,16H,2-5,9,21H2,1H3,(H,23,24) |
| InChIKey | TVMKMYQAPHXCCS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |