C16H18N2O3 — CID 119616565
N-(2-amino-1-cyclopropylethyl)-4-methyl-2-oxochromene-3-carboxamide (PubChem CID 119616565) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-methyl-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-methyl-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 119616565 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-methyl-2-oxochromene-3-carboxamide |
| SMILES | Cc1c(C(=O)NC(CN)C2CC2)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C16H18N2O3/c1-9-11-4-2-3-5-13(11)21-16(20)14(9)15(19)18-12(8-17)10-6-7-10/h2-5,10,12H,6-8,17H2,1H3,(H,18,19) |
| InChIKey | GQJDVXGOFOCXBU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|