C17H23ClN2O3 — CID 119642890
N-(2-amino-2-ethylbutyl)-4-methyl-2-oxochromene-3-carboxamide;hydrochloride (PubChem CID 119642890) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-methyl-2-oxochromene-3-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-methyl-2-oxochromene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119642890 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-methyl-2-oxochromene-3-carboxamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1c(C)c2ccccc2oc1=O.Cl |
| InChI | InChI=1S/C17H22N2O3.ClH/c1-4-17(18,5-2)10-19-15(20)14-11(3)12-8-6-7-9-13(12)22-16(14)21;/h6-9H,4-5,10,18H2,1-3H3,(H,19,20);1H |
| InChIKey | QZLBSTNAONSPGY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|