C20H20N4O4 — CID 119618461
N-(6-amino-1,3-benzodioxol-5-yl)-6-cyclopropyl-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 119618461) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-6-cyclopropyl-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-6-cyclopropyl-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119618461 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-6-cyclopropyl-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)c1noc2nc(C3CC3)cc(C(=O)Nc3cc4c(cc3N)OCO4)c12 |
| InChI | InChI=1S/C20H20N4O4/c1-9(2)18-17-11(5-13(10-3-4-10)23-20(17)28-24-18)19(25)22-14-7-16-15(6-12(14)21)26-8-27-16/h5-7,9-10H,3-4,8,21H2,1-2H3,(H,22,25) |
| InChIKey | CQKKMKRVQQAVPZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|