C18H20ClFN2O3 — CID 119618946
N-(6-amino-1,3-benzodioxol-5-yl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride (PubChem CID 119618946) has the molecular formula C18H20ClFN2O3 and a molecular weight of 366.82 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119618946 |
| Molecular Formula | C18H20ClFN2O3 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1cc2c(cc1N)OCO2)Cc1cccc(F)c1.Cl |
| InChI | InChI=1S/C18H19FN2O3.ClH/c1-11(5-12-3-2-4-13(19)7-12)6-18(22)21-15-9-17-16(8-14(15)20)23-10-24-17;/h2-4,7-9,11H,5-6,10,20H2,1H3,(H,21,22);1H |
| InChIKey | FKVGRCIHICWYED-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|