C16H22ClN3O4 — CID 119619025
N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-oxoazocan-1-yl)acetamide;hydrochloride (PubChem CID 119619025) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-oxoazocan-1-yl)acetamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-oxoazocan-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119619025 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(2-oxoazocan-1-yl)acetamide;hydrochloride |
| SMILES | Cl.Nc1cc2c(cc1NC(=O)CN1CCCCCCC1=O)OCO2 |
| InChI | InChI=1S/C16H21N3O4.ClH/c17-11-7-13-14(23-10-22-13)8-12(11)18-15(20)9-19-6-4-2-1-3-5-16(19)21;/h7-8H,1-6,9-10,17H2,(H,18,20);1H |
| InChIKey | JLUVKONBVFCYEG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|