C15H19ClN4O5 — CID 119618728
N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide;hydrochloride (PubChem CID 119618728) has the molecular formula C15H19ClN4O5 and a molecular weight of 370.79 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119618728 |
| Molecular Formula | C15H19ClN4O5 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetamide;hydrochloride |
| SMILES | CCN1CCN(CC(=O)Nc2cc3c(cc2N)OCO3)C(=O)C1=O.Cl |
| InChI | InChI=1S/C15H18N4O5.ClH/c1-2-18-3-4-19(15(22)14(18)21)7-13(20)17-10-6-12-11(5-9(10)16)23-8-24-12;/h5-6H,2-4,7-8,16H2,1H3,(H,17,20);1H |
| InChIKey | UOIMVEDITKFGBA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|