C20H25NO4S — CID 11961916
methyl (5aS,7R,8R,8aR)-7-ethenyl-1-(4-methylphenyl)sulfonyl-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]azepine-8-carboxylate (PubChem CID 11961916) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl (5aS,7R,8R,8aR)-7-ethenyl-1-(4-methylphenyl)sulfonyl-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]azepine-8-carboxylate.
| Compound Name | methyl (5aS,7R,8R,8aR)-7-ethenyl-1-(4-methylphenyl)sulfonyl-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]azepine-8-carboxylate |
|---|---|
| PubChem CID | 11961916 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl (5aS,7R,8R,8aR)-7-ethenyl-1-(4-methylphenyl)sulfonyl-3,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]azepine-8-carboxylate |
| SMILES | C=C[C@H]1C[C@H]2C=CCCN(S(=O)(=O)c3ccc(C)cc3)[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C20H25NO4S/c1-4-15-13-16-7-5-6-12-21(19(16)18(15)20(22)25-3)26(23,24)17-10-8-14(2)9-11-17/h4-5,7-11,15-16,18-19H,1,6,12-13H2,2-3H3/t15-,16+,18+,19+/m0/s1 |
| InChIKey | UOPYYUVTDYJDQS-QFHJOOASSA-N |
| XLogP | 2.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|