C20H32N4O2 — CID 119619279
3-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]-3-(2-methylphenyl)propanamide (PubChem CID 119619279) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]-3-(2-methylphenyl)propanamide.
| Compound Name | 3-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 119619279 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 3-(carbamoylamino)-N-[2-(cycloheptylamino)ethyl]-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1C(CC(=O)NCCNC1CCCCCC1)NC(N)=O |
| InChI | InChI=1S/C20H32N4O2/c1-15-8-6-7-11-17(15)18(24-20(21)26)14-19(25)23-13-12-22-16-9-4-2-3-5-10-16/h6-8,11,16,18,22H,2-5,9-10,12-14H2,1H3,(H,23,25)(H3,21,24,26) |
| InChIKey | OUZRBNRXIYYRIT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|