C20H30N4O2 — CID 119621791
[3-[4-(cyclopropylmethylamino)piperidin-1-yl]-1-(2-methylphenyl)-3-oxopropyl]urea (PubChem CID 119621791) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is [3-[4-(cyclopropylmethylamino)piperidin-1-yl]-1-(2-methylphenyl)-3-oxopropyl]urea.
| Compound Name | [3-[4-(cyclopropylmethylamino)piperidin-1-yl]-1-(2-methylphenyl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 119621791 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | [3-[4-(cyclopropylmethylamino)piperidin-1-yl]-1-(2-methylphenyl)-3-oxopropyl]urea |
| SMILES | Cc1ccccc1C(CC(=O)N1CCC(NCC2CC2)CC1)NC(N)=O |
| InChI | InChI=1S/C20H30N4O2/c1-14-4-2-3-5-17(14)18(23-20(21)26)12-19(25)24-10-8-16(9-11-24)22-13-15-6-7-15/h2-5,15-16,18,22H,6-13H2,1H3,(H3,21,23,26) |
| InChIKey | DOOQSGPWIUPZGE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |