C16H21ClN4O3 — CID 42997460
[3-(4-acetylpiperazin-1-yl)-1-(2-chlorophenyl)-3-oxopropyl]urea (PubChem CID 42997460) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is [3-(4-acetylpiperazin-1-yl)-1-(2-chlorophenyl)-3-oxopropyl]urea.
| Compound Name | [3-(4-acetylpiperazin-1-yl)-1-(2-chlorophenyl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 42997460 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [3-(4-acetylpiperazin-1-yl)-1-(2-chlorophenyl)-3-oxopropyl]urea |
| SMILES | CC(=O)N1CCN(C(=O)CC(NC(N)=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H21ClN4O3/c1-11(22)20-6-8-21(9-7-20)15(23)10-14(19-16(18)24)12-4-2-3-5-13(12)17/h2-5,14H,6-10H2,1H3,(H3,18,19,24) |
| InChIKey | VKTISCUGLAKPMM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |