C17H24ClN3O4 — CID 7757813
[2-oxo-2-(pentan-3-ylamino)ethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate (PubChem CID 7757813) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 7757813 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate |
| SMILES | CCC(CC)NC(=O)COC(=O)C[C@H](NC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H24ClN3O4/c1-3-11(4-2)20-15(22)10-25-16(23)9-14(21-17(19)24)12-7-5-6-8-13(12)18/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,20,22)(H3,19,21,24)/t14-/m0/s1 |
| InChIKey | NNMPYXKAQKYIKU-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |