C15H18ClN3O6 — CID 7757828
[2-(ethoxycarbonylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate (PubChem CID 7757828) has the molecular formula C15H18ClN3O6 and a molecular weight of 371.78 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 7757828 |
| Molecular Formula | C15H18ClN3O6 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)C[C@H](NC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H18ClN3O6/c1-2-24-15(23)19-12(20)8-25-13(21)7-11(18-14(17)22)9-5-3-4-6-10(9)16/h3-6,11H,2,7-8H2,1H3,(H3,17,18,22)(H,19,20,23)/t11-/m0/s1 |
| InChIKey | MHAWCYONNUWFKL-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |