C21H24ClNO3 — CID 7310535
ethyl (3S)-3-(2-chlorophenyl)-3-(4-phenylbutanoylamino)propanoate (PubChem CID 7310535) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is ethyl (3S)-3-(2-chlorophenyl)-3-(4-phenylbutanoylamino)propanoate.
| Compound Name | ethyl (3S)-3-(2-chlorophenyl)-3-(4-phenylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 7310535 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | ethyl (3S)-3-(2-chlorophenyl)-3-(4-phenylbutanoylamino)propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)CCCc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H24ClNO3/c1-2-26-21(25)15-19(17-12-6-7-13-18(17)22)23-20(24)14-8-11-16-9-4-3-5-10-16/h3-7,9-10,12-13,19H,2,8,11,14-15H2,1H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | KGKXEOLWTULDCF-IBGZPJMESA-N |
| XLogP | 4.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |