C19H20ClN3O5 — CID 7757929
[2-(3-methoxyanilino)-2-oxoethyl] (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate (PubChem CID 7757929) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 7757929 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (3R)-3-(carbamoylamino)-3-(2-chlorophenyl)propanoate |
| SMILES | COc1cccc(NC(=O)COC(=O)C[C@@H](NC(N)=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O5/c1-27-13-6-4-5-12(9-13)22-17(24)11-28-18(25)10-16(23-19(21)26)14-7-2-3-8-15(14)20/h2-9,16H,10-11H2,1H3,(H,22,24)(H3,21,23,26)/t16-/m1/s1 |
| InChIKey | UAFHMGSWKYZSLJ-MRXNPFEDSA-N |
| XLogP | 2.63 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |