C20H32N2O3S — CID 119620592
N-[2-(cycloheptylamino)ethyl]-3-(3,4-dimethoxyphenyl)sulfanylpropanamide (PubChem CID 119620592) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-(3,4-dimethoxyphenyl)sulfanylpropanamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-(3,4-dimethoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 119620592 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-(3,4-dimethoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(SCCC(=O)NCCNC2CCCCCC2)cc1OC |
| InChI | InChI=1S/C20H32N2O3S/c1-24-18-10-9-17(15-19(18)25-2)26-14-11-20(23)22-13-12-21-16-7-5-3-4-6-8-16/h9-10,15-16,21H,3-8,11-14H2,1-2H3,(H,22,23) |
| InChIKey | KJNYEXAJXGHXMF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|