C20H31N5O3 — CID 119620890
N-[2-(cycloheptylamino)ethyl]-1-(6-oxo-1H-pyridazine-3-carbonyl)piperidine-2-carboxamide (PubChem CID 119620890) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-1-(6-oxo-1H-pyridazine-3-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-1-(6-oxo-1H-pyridazine-3-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119620890 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-1-(6-oxo-1H-pyridazine-3-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCNC1CCCCCC1)C1CCCCN1C(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C20H31N5O3/c26-18-11-10-16(23-24-18)20(28)25-14-6-5-9-17(25)19(27)22-13-12-21-15-7-3-1-2-4-8-15/h10-11,15,17,21H,1-9,12-14H2,(H,22,27)(H,24,26) |
| InChIKey | ADRADWBATHWEQJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|