C20H26BrN3O3 — CID 52831006
(2R)-1-(4-bromobenzoyl)-N-[2-(cyclopentanecarbonylamino)ethyl]pyrrolidine-2-carboxamide (PubChem CID 52831006) has the molecular formula C20H26BrN3O3 and a molecular weight of 436.35 g/mol. Its IUPAC name is (2R)-1-(4-bromobenzoyl)-N-[2-(cyclopentanecarbonylamino)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(4-bromobenzoyl)-N-[2-(cyclopentanecarbonylamino)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 52831006 |
| Molecular Formula | C20H26BrN3O3 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (2R)-1-(4-bromobenzoyl)-N-[2-(cyclopentanecarbonylamino)ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@H]1CCCN1C(=O)c1ccc(Br)cc1)C1CCCC1 |
| InChI | InChI=1S/C20H26BrN3O3/c21-16-9-7-15(8-10-16)20(27)24-13-3-6-17(24)19(26)23-12-11-22-18(25)14-4-1-2-5-14/h7-10,14,17H,1-6,11-13H2,(H,22,25)(H,23,26)/t17-/m1/s1 |
| InChIKey | OANAWRFJRLFNKO-QGZVFWFLSA-N |
| XLogP | 2.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|