C16H21BrN2O3 — CID 86803364
1-(4-bromobenzoyl)-N-[(2S)-1-hydroxybutan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 86803364) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-[(2S)-1-hydroxybutan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-[(2S)-1-hydroxybutan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86803364 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-[(2S)-1-hydroxybutan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC[C@@H](CO)NC(=O)C1CCCN1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H21BrN2O3/c1-2-13(10-20)18-15(21)14-4-3-9-19(14)16(22)11-5-7-12(17)8-6-11/h5-8,13-14,20H,2-4,9-10H2,1H3,(H,18,21)/t13-,14?/m0/s1 |
| InChIKey | LDKMJOBOCGPFKK-LSLKUGRBSA-N |
| XLogP | 1.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |