C18H23BrN2O4 — CID 60613077
methyl 5-[[1-(4-bromobenzoyl)pyrrolidine-2-carbonyl]amino]pentanoate (PubChem CID 60613077) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is methyl 5-[[1-(4-bromobenzoyl)pyrrolidine-2-carbonyl]amino]pentanoate.
| Compound Name | methyl 5-[[1-(4-bromobenzoyl)pyrrolidine-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 60613077 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | methyl 5-[[1-(4-bromobenzoyl)pyrrolidine-2-carbonyl]amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)C1CCCN1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H23BrN2O4/c1-25-16(22)6-2-3-11-20-17(23)15-5-4-12-21(15)18(24)13-7-9-14(19)10-8-13/h7-10,15H,2-6,11-12H2,1H3,(H,20,23) |
| InChIKey | UAQVDIWYZGBPJO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|