C17H28Cl2N6O — CID 119620946
N-[2-(cycloheptylamino)ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide;dihydrochloride (PubChem CID 119620946) has the molecular formula C17H28Cl2N6O and a molecular weight of 403.36 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119620946 |
| Molecular Formula | C17H28Cl2N6O |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide;dihydrochloride |
| SMILES | Cc1cc(C)n2nc(C(=O)NCCNC3CCCCCC3)nc2n1.Cl.Cl |
| InChI | InChI=1S/C17H26N6O.2ClH/c1-12-11-13(2)23-17(20-12)21-15(22-23)16(24)19-10-9-18-14-7-5-3-4-6-8-14;;/h11,14,18H,3-10H2,1-2H3,(H,19,24);2*1H |
| InChIKey | WPMGLFBPUCKGFW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|