C22H35ClN2O2 — CID 119622930
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one;hydrochloride (PubChem CID 119622930) has the molecular formula C22H35ClN2O2 and a molecular weight of 394.99 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one;hydrochloride.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119622930 |
| Molecular Formula | C22H35ClN2O2 |
| Molecular Weight | 394.99 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-6-(4-methoxyphenyl)hexan-1-one;hydrochloride |
| SMILES | COc1ccc(CCCCCC(=O)N2CCC(NCC3CC3)CC2)cc1.Cl |
| InChI | InChI=1S/C22H34N2O2.ClH/c1-26-21-11-9-18(10-12-21)5-3-2-4-6-22(25)24-15-13-20(14-16-24)23-17-19-7-8-19;/h9-12,19-20,23H,2-8,13-17H2,1H3;1H |
| InChIKey | XERBAHVDRIYQGU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.99 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|