C19H27BrN2O — CID 119623061
3-(4-bromo-3-methylphenyl)-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one (PubChem CID 119623061) has the molecular formula C19H27BrN2O and a molecular weight of 379.34 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(4-bromo-3-methylphenyl)-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119623061 |
| Molecular Formula | C19H27BrN2O |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-1-[4-(cyclopropylmethylamino)piperidin-1-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)N2CCC(NCC3CC3)CC2)ccc1Br |
| InChI | InChI=1S/C19H27BrN2O/c1-14-12-15(4-6-18(14)20)5-7-19(23)22-10-8-17(9-11-22)21-13-16-2-3-16/h4,6,12,16-17,21H,2-3,5,7-11,13H2,1H3 |
| InChIKey | DEWPEDWNBBPBLO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |