C14H17N3O3 — CID 119631026
6-[2-(aminomethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 119631026) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-[2-(aminomethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(aminomethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 119631026 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 6-[2-(aminomethyl)pyrrolidine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | NCC1CCCN1C(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H17N3O3/c15-7-10-2-1-5-17(10)14(19)9-3-4-12-11(6-9)16-13(18)8-20-12/h3-4,6,10H,1-2,5,7-8,15H2,(H,16,18) |
| InChIKey | KBZZSBLZWDUVJB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |