C14H27ClN2O2 — CID 119635204
1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-pentoxyethanone;hydrochloride (PubChem CID 119635204) has the molecular formula C14H27ClN2O2 and a molecular weight of 290.83 g/mol. Its IUPAC name is 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-pentoxyethanone;hydrochloride.
| Compound Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-pentoxyethanone;hydrochloride |
|---|---|
| PubChem CID | 119635204 |
| Molecular Formula | C14H27ClN2O2 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-pentoxyethanone;hydrochloride |
| SMILES | CCCCCOCC(=O)N1CCC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C14H26N2O2.ClH/c1-2-3-4-9-18-11-14(17)16-8-7-12-5-6-13(10-16)15-12;/h12-13,15H,2-11H2,1H3;1H |
| InChIKey | QHGBREIWAIBBRC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|