C17H22ClFN2O2 — CID 119640271
N-(2-amino-2-ethylbutyl)-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride (PubChem CID 119640271) has the molecular formula C17H22ClFN2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119640271 |
| Molecular Formula | C17H22ClFN2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-5-(2-fluorophenyl)furan-2-carboxamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1ccc(-c2ccccc2F)o1.Cl |
| InChI | InChI=1S/C17H21FN2O2.ClH/c1-3-17(19,4-2)11-20-16(21)15-10-9-14(22-15)12-7-5-6-8-13(12)18;/h5-10H,3-4,11,19H2,1-2H3,(H,20,21);1H |
| InChIKey | LGIQXNKGPYKNOW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |