C13H23NSi — CID 11964134
1-(2,4,6-trimethylphenyl)-N-trimethylsilylmethanamine (PubChem CID 11964134) has the molecular formula C13H23NSi and a molecular weight of 221.42 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)-N-trimethylsilylmethanamine.
| Compound Name | 1-(2,4,6-trimethylphenyl)-N-trimethylsilylmethanamine |
|---|---|
| PubChem CID | 11964134 |
| Molecular Formula | C13H23NSi |
| Molecular Weight | 221.42 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)-N-trimethylsilylmethanamine |
| SMILES | Cc1cc(C)c(CN[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C13H23NSi/c1-10-7-11(2)13(12(3)8-10)9-14-15(4,5)6/h7-8,14H,9H2,1-6H3 |
| InChIKey | YBVQDHQYSDWHFW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|