C13H11ClN2O4 — CID 11964367
ethyl 6-(4-chlorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxylate (PubChem CID 11964367) has the molecular formula C13H11ClN2O4 and a molecular weight of 294.69 g/mol. Its IUPAC name is ethyl 6-(4-chlorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-(4-chlorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11964367 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | ethyl 6-(4-chlorophenyl)-2,4-dioxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H11ClN2O4/c1-2-20-12(18)9-10(15-13(19)16-11(9)17)7-3-5-8(14)6-4-7/h3-6H,2H2,1H3,(H2,15,16,17,19) |
| InChIKey | QVUHSLUQMWLXTG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |