C16H35Cl2N3OS — CID 119645558
2-[2-(diethylamino)ethylsulfanyl]-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;dihydrochloride (PubChem CID 119645558) has the molecular formula C16H35Cl2N3OS and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119645558 |
| Molecular Formula | C16H35Cl2N3OS |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;dihydrochloride |
| SMILES | CCNCC1CCN(C(=O)CSCCN(CC)CC)CC1.Cl.Cl |
| InChI | InChI=1S/C16H33N3OS.2ClH/c1-4-17-13-15-7-9-19(10-8-15)16(20)14-21-12-11-18(5-2)6-3;;/h15,17H,4-14H2,1-3H3;2*1H |
| InChIKey | QGTPBVGCNGQCOT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|