C16H24Cl2N2O3S — CID 119648007
2-(4-chlorophenyl)sulfonyl-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;hydrochloride (PubChem CID 119648007) has the molecular formula C16H24Cl2N2O3S and a molecular weight of 395.35 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119648007 |
| Molecular Formula | C16H24Cl2N2O3S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-[4-(ethylaminomethyl)piperidin-1-yl]ethanone;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)CS(=O)(=O)c2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C16H23ClN2O3S.ClH/c1-2-18-11-13-7-9-19(10-8-13)16(20)12-23(21,22)15-5-3-14(17)4-6-15;/h3-6,13,18H,2,7-12H2,1H3;1H |
| InChIKey | BKHQDGQAZYTXPC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |