C26H24N2O5S — CID 11965215
[7-methyl-4-oxo-3-(phenylcarbamoyloxymethyl)-2H-thiochromen-3-yl]methyl N-phenylcarbamate (PubChem CID 11965215) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is [7-methyl-4-oxo-3-(phenylcarbamoyloxymethyl)-2H-thiochromen-3-yl]methyl N-phenylcarbamate.
| Compound Name | [7-methyl-4-oxo-3-(phenylcarbamoyloxymethyl)-2H-thiochromen-3-yl]methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 11965215 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [7-methyl-4-oxo-3-(phenylcarbamoyloxymethyl)-2H-thiochromen-3-yl]methyl N-phenylcarbamate |
| SMILES | Cc1ccc2c(c1)SCC(COC(=O)Nc1ccccc1)(COC(=O)Nc1ccccc1)C2=O |
| InChI | InChI=1S/C26H24N2O5S/c1-18-12-13-21-22(14-18)34-17-26(23(21)29,15-32-24(30)27-19-8-4-2-5-9-19)16-33-25(31)28-20-10-6-3-7-11-20/h2-14H,15-17H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | TXZNLUUHPRHUMJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |