C20H28N2O4 — CID 119653240
N-(3-amino-2,2-dimethylpropyl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide (PubChem CID 119653240) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 119653240 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide |
| SMILES | COc1ccc2c(C)c(CCC(=O)N(C)CC(C)(C)CN)c(=O)oc2c1 |
| InChI | InChI=1S/C20H28N2O4/c1-13-15-7-6-14(25-5)10-17(15)26-19(24)16(13)8-9-18(23)22(4)12-20(2,3)11-21/h6-7,10H,8-9,11-12,21H2,1-5H3 |
| InChIKey | JDOCTYPNQVSEFN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|