C20H29ClN2O4 — CID 119569253
N-[3-(aminomethyl)pentan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide;hydrochloride (PubChem CID 119569253) has the molecular formula C20H29ClN2O4 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119569253 |
| Molecular Formula | C20H29ClN2O4 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-(7-methoxy-4-methyl-2-oxochromen-3-yl)propanamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)CCc1c(C)c2ccc(OC)cc2oc1=O.Cl |
| InChI | InChI=1S/C20H28N2O4.ClH/c1-5-20(6-2,12-21)22-18(23)10-9-16-13(3)15-8-7-14(25-4)11-17(15)26-19(16)24;/h7-8,11H,5-6,9-10,12,21H2,1-4H3,(H,22,23);1H |
| InChIKey | GKMQTKDZUIZLHO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|