C11H19N5O3 — CID 119653864
N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 119653864) has the molecular formula C11H19N5O3 and a molecular weight of 269.31 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 119653864 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | CN(CC(C)(C)CN)C(=O)Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H19N5O3/c1-11(2,7-12)8-14(3)10(17)6-15-5-9(4-13-15)16(18)19/h4-5H,6-8,12H2,1-3H3 |
| InChIKey | AGIDMCNEYTZQER-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|