C12H22ClN5O3 — CID 119654576
N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(4-nitropyrazol-1-yl)propanamide;hydrochloride (PubChem CID 119654576) has the molecular formula C12H22ClN5O3 and a molecular weight of 319.79 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(4-nitropyrazol-1-yl)propanamide;hydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(4-nitropyrazol-1-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119654576 |
| Molecular Formula | C12H22ClN5O3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-(4-nitropyrazol-1-yl)propanamide;hydrochloride |
| SMILES | CN(CC(C)(C)CN)C(=O)CCn1cc([N+](=O)[O-])cn1.Cl |
| InChI | InChI=1S/C12H21N5O3.ClH/c1-12(2,8-13)9-15(3)11(18)4-5-16-7-10(6-14-16)17(19)20;/h6-7H,4-5,8-9,13H2,1-3H3;1H |
| InChIKey | CSUFZNJMTIIQMM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|