C12H26Cl2N2O — CID 119656537
N-(3-amino-2,2-dimethylpropyl)-N-methylhex-5-enamide;dihydrochloride (PubChem CID 119656537) has the molecular formula C12H26Cl2N2O and a molecular weight of 285.26 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methylhex-5-enamide;dihydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methylhex-5-enamide;dihydrochloride |
|---|---|
| PubChem CID | 119656537 |
| Molecular Formula | C12H26Cl2N2O |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methylhex-5-enamide;dihydrochloride |
| SMILES | C=CCCCC(=O)N(C)CC(C)(C)CN.Cl.Cl |
| InChI | InChI=1S/C12H24N2O.2ClH/c1-5-6-7-8-11(15)14(4)10-12(2,3)9-13;;/h5H,1,6-10,13H2,2-4H3;2*1H |
| InChIKey | YVLAQJIOCGVIKE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|