C19H24ClN3O3S — CID 119656848
N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitro-2-phenylsulfanylbenzamide;hydrochloride (PubChem CID 119656848) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitro-2-phenylsulfanylbenzamide;hydrochloride.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitro-2-phenylsulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119656848 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-methyl-5-nitro-2-phenylsulfanylbenzamide;hydrochloride |
| SMILES | CN(CC(C)(C)CN)C(=O)c1cc([N+](=O)[O-])ccc1Sc1ccccc1.Cl |
| InChI | InChI=1S/C19H23N3O3S.ClH/c1-19(2,12-20)13-21(3)18(23)16-11-14(22(24)25)9-10-17(16)26-15-7-5-4-6-8-15;/h4-11H,12-13,20H2,1-3H3;1H |
| InChIKey | ICGPEGIDOKTDAC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|