C12H16N2O3S — CID 84599436
N,N-dimethyl-5-nitro-2-propylsulfanylbenzamide (PubChem CID 84599436) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N,N-dimethyl-5-nitro-2-propylsulfanylbenzamide.
| Compound Name | N,N-dimethyl-5-nitro-2-propylsulfanylbenzamide |
|---|---|
| PubChem CID | 84599436 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N,N-dimethyl-5-nitro-2-propylsulfanylbenzamide |
| SMILES | CCCSc1ccc([N+](=O)[O-])cc1C(=O)N(C)C |
| InChI | InChI=1S/C12H16N2O3S/c1-4-7-18-11-6-5-9(14(16)17)8-10(11)12(15)13(2)3/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | IQNCGMWTLVGDDU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|