C10H13N3O3S — CID 76935073
N'-hydroxy-5-nitro-2-propylsulfanylbenzenecarboximidamide (PubChem CID 76935073) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N'-hydroxy-5-nitro-2-propylsulfanylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-5-nitro-2-propylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 76935073 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N'-hydroxy-5-nitro-2-propylsulfanylbenzenecarboximidamide |
| SMILES | CCCSc1ccc([N+](=O)[O-])cc1C(N)=NO |
| InChI | InChI=1S/C10H13N3O3S/c1-2-5-17-9-4-3-7(13(15)16)6-8(9)10(11)12-14/h3-4,6,14H,2,5H2,1H3,(H2,11,12) |
| InChIKey | MVWSQDYRIQWAKF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|