C18H30ClN3O2 — CID 119657358
N-(3-amino-4-methylpentyl)-N-methyl-3-[(2-phenylacetyl)amino]propanamide;hydrochloride (PubChem CID 119657358) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-3-[(2-phenylacetyl)amino]propanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-3-[(2-phenylacetyl)amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119657358 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-3-[(2-phenylacetyl)amino]propanamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCNC(=O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C18H29N3O2.ClH/c1-14(2)16(19)10-12-21(3)18(23)9-11-20-17(22)13-15-7-5-4-6-8-15;/h4-8,14,16H,9-13,19H2,1-3H3,(H,20,22);1H |
| InChIKey | FLUVGIWROPNAHO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |