C17H28ClN3O2 — CID 119657837
N-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]-2-phenylacetamide;hydrochloride (PubChem CID 119657837) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is N-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]-2-phenylacetamide;hydrochloride.
| Compound Name | N-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119657837 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[2-[(3-amino-4-methylpentyl)-methylamino]-2-oxoethyl]-2-phenylacetamide;hydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)CNC(=O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C17H27N3O2.ClH/c1-13(2)15(18)9-10-20(3)17(22)12-19-16(21)11-14-7-5-4-6-8-14;/h4-8,13,15H,9-12,18H2,1-3H3,(H,19,21);1H |
| InChIKey | VJZBRSVNTBSQLR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |